C12H5FN2O4S — CID 142468658
(3Z)-6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylidene)-2-benzofuran-1-one (PubChem CID 142468658) has the molecular formula C12H5FN2O4S and a molecular weight of 292.25 g/mol. Its IUPAC name is (3Z)-6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylidene)-2-benzofuran-1-one.
| Compound Name | (3Z)-6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylidene)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 142468658 |
| Molecular Formula | C12H5FN2O4S |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | (3Z)-6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylidene)-2-benzofuran-1-one |
| SMILES | O=C1O/C(=C\c2nccs2)c2c1cc(F)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C12H5FN2O4S/c13-6-3-7-11(8(4-6)15(17)18)9(19-12(7)16)5-10-14-1-2-20-10/h1-5H/b9-5- |
| InChIKey | RXFJUEFGBDUGQV-UITAMQMPSA-N |
| XLogP | 2.86 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|