C13H8N4 — CID 142468812
3,5,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 142468812) has the molecular formula C13H8N4 and a molecular weight of 220.24 g/mol. Its IUPAC name is 3,5,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 3,5,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 142468812 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3,5,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | c1cnc2[nH]c3c(ccc4cncnc43)c2c1 |
| InChI | InChI=1S/C13H8N4/c1-2-10-9-4-3-8-6-14-7-16-11(8)12(9)17-13(10)15-5-1/h1-7H,(H,15,17) |
| InChIKey | LKGYRDNWOJWDJD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |