C28H31ClN8O2 — CID 142468965
1-[(7S)-11-chloro-16-[2-(dimethylamino)ethylamino]-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one (PubChem CID 142468965) has the molecular formula C28H31ClN8O2 and a molecular weight of 547.06 g/mol. Its IUPAC name is 1-[(7S)-11-chloro-16-[2-(dimethylamino)ethylamino]-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(7S)-11-chloro-16-[2-(dimethylamino)ethylamino]-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142468965 |
| Molecular Formula | C28H31ClN8O2 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-[(7S)-11-chloro-16-[2-(dimethylamino)ethylamino]-12-(5-methyl-1H-indazol-4-yl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3nc(NCCN(C)C)nc4cc(-c5c(C)ccc6[nH]ncc56)c(Cl)c(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C28H31ClN8O2/c1-5-22(38)36-10-11-37-17(14-36)15-39-26-24-21(32-28(33-27(24)37)30-8-9-35(3)4)12-18(25(26)29)23-16(2)6-7-20-19(23)13-31-34-20/h5-7,12-13,17H,1,8-11,14-15H2,2-4H3,(H,31,34)(H,30,32,33)/t17-/m0/s1 |
| InChIKey | BTSLADGESTVJLG-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|