C21H29N3O8S — CID 142470080
[5-[[(2S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyloxy]-4,4-dimethylpentyl] benzoate (PubChem CID 142470080) has the molecular formula C21H29N3O8S and a molecular weight of 483.54 g/mol. Its IUPAC name is [5-[[(2S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyloxy]-4,4-dimethylpentyl] benzoate.
| Compound Name | [5-[[(2S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyloxy]-4,4-dimethylpentyl] benzoate |
|---|---|
| PubChem CID | 142470080 |
| Molecular Formula | C21H29N3O8S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [5-[[(2S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyloxy]-4,4-dimethylpentyl] benzoate |
| SMILES | CC(C)(CCCOC(=O)c1ccccc1)COS(=O)(=O)ON1C(=O)N2CC1CC[C@H]2C(N)=O |
| InChI | InChI=1S/C21H29N3O8S/c1-21(2,11-6-12-30-19(26)15-7-4-3-5-8-15)14-31-33(28,29)32-24-16-9-10-17(18(22)25)23(13-16)20(24)27/h3-5,7-8,16-17H,6,9-14H2,1-2H3,(H2,22,25)/t16?,17-/m0/s1 |
| InChIKey | RFCIAQLJQLLYRP-DJNXLDHESA-N |
| XLogP | 1.60 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|