C24H23N7O7 — CID 142470536
[[N-methyl-C-[(7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino] (4-nitrophenyl) carbonate (PubChem CID 142470536) has the molecular formula C24H23N7O7 and a molecular weight of 521.49 g/mol. Its IUPAC name is [[N-methyl-C-[(7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino] (4-nitrophenyl) carbonate.
| Compound Name | [[N-methyl-C-[(7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 142470536 |
| Molecular Formula | C24H23N7O7 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [[N-methyl-C-[(7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino] (4-nitrophenyl) carbonate |
| SMILES | C/N=C(\NOC(=O)Oc1ccc([N+](=O)[O-])cc1)[C@@H]1c2c(cnn2C)C2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C24H23N7O7/c1-25-22(27-38-24(33)37-17-10-8-16(9-11-17)31(34)35)21-20-18(12-26-28(20)2)19-13-29(21)23(32)30(19)36-14-15-6-4-3-5-7-15/h3-12,19,21H,13-14H2,1-2H3,(H,25,27)/t19?,21-/m0/s1 |
| InChIKey | VKCOCRKQRPMMNY-QWAKEFERSA-N |
| XLogP | 3.04 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|