C19H26N6O5 — CID 142470544
N-hydroxy-N'-methylmethanimidamide;methanol;2-(9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl)acetaldehyde (PubChem CID 142470544) has the molecular formula C19H26N6O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-hydroxy-N'-methylmethanimidamide;methanol;2-(9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl)acetaldehyde.
| Compound Name | N-hydroxy-N'-methylmethanimidamide;methanol;2-(9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 142470544 |
| Molecular Formula | C19H26N6O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-hydroxy-N'-methylmethanimidamide;methanol;2-(9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl)acetaldehyde |
| SMILES | C/N=C/NO.CO.O=CCn1ncc2c1CN1CC2N(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C16H16N4O3.C2H6N2O.CH4O/c21-7-6-19-14-9-18-10-15(13(14)8-17-19)20(16(18)22)23-11-12-4-2-1-3-5-12;1-3-2-4-5;1-2/h1-5,7-8,15H,6,9-11H2;2,5H,1H3,(H,3,4);2H,1H3 |
| InChIKey | YDVNPNOIILYSSG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|