C29H49NO4 — CID 142470752
(9Z,12Z,15Z,18Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxotetracosa-9,12,15,18-tetraenoate (PubChem CID 142470752) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is (9Z,12Z,15Z,18Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxotetracosa-9,12,15,18-tetraenoate.
| Compound Name | (9Z,12Z,15Z,18Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxotetracosa-9,12,15,18-tetraenoate |
|---|---|
| PubChem CID | 142470752 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | (9Z,12Z,15Z,18Z)-2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxotetracosa-9,12,15,18-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C29H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26(31)28(29(33)34)27(32)25-30(2,3)4/h9-10,12-13,15-16,18-19,27-28,32H,5-8,11,14,17,20-25H2,1-4H3/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | NOOVQASQKNUFLE-SNPVRQPZSA-N |
| XLogP | 4.91 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|