C27H28F2N4O5S — CID 142470878
N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-3-[4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]ethynyl]phenyl]propanamide (PubChem CID 142470878) has the molecular formula C27H28F2N4O5S and a molecular weight of 558.61 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-3-[4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]ethynyl]phenyl]propanamide.
| Compound Name | N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-3-[4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]ethynyl]phenyl]propanamide |
|---|---|
| PubChem CID | 142470878 |
| Molecular Formula | C27H28F2N4O5S |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-3-[4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]ethynyl]phenyl]propanamide |
| SMILES | CS(=O)(=O)CCNCc1ccc(C#Cc2ccc(CC(C(=O)NCC(F)F)c3nc[nH]c(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C27H28F2N4O5S/c1-39(37,38)13-12-30-15-21-10-6-19(7-11-21)3-2-18-4-8-20(9-5-18)14-22(26(35)31-16-23(28)29)24-25(34)27(36)33-17-32-24/h4-11,17,22-23,30,34H,12-16H2,1H3,(H,31,35)(H,32,33,36) |
| InChIKey | NSTOLXHMPZQMOQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|