C26H23F2N5O3 — CID 142470892
3-[4-[2-[4-[(cyanomethylamino)methyl]phenyl]ethynyl]phenyl]-N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide (PubChem CID 142470892) has the molecular formula C26H23F2N5O3 and a molecular weight of 491.50 g/mol. Its IUPAC name is 3-[4-[2-[4-[(cyanomethylamino)methyl]phenyl]ethynyl]phenyl]-N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide.
| Compound Name | 3-[4-[2-[4-[(cyanomethylamino)methyl]phenyl]ethynyl]phenyl]-N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide |
|---|---|
| PubChem CID | 142470892 |
| Molecular Formula | C26H23F2N5O3 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 3-[4-[2-[4-[(cyanomethylamino)methyl]phenyl]ethynyl]phenyl]-N-(2,2-difluoroethyl)-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide |
| SMILES | N#CCNCc1ccc(C#Cc2ccc(CC(C(=O)NCC(F)F)c3nc[nH]c(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C26H23F2N5O3/c27-22(28)15-31-25(35)21(23-24(34)26(36)33-16-32-23)13-19-7-3-17(4-8-19)1-2-18-5-9-20(10-6-18)14-30-12-11-29/h3-10,16,21-22,30,34H,12-15H2,(H,31,35)(H,32,33,36) |
| InChIKey | YNLUMZAEWTUJAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|