C28H31FN4O3S — CID 142470930
4-[1-(2-fluoroethylamino)-3-[4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 142470930) has the molecular formula C28H31FN4O3S and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-[1-(2-fluoroethylamino)-3-[4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(2-fluoroethylamino)-3-[4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 142470930 |
| Molecular Formula | C28H31FN4O3S |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 4-[1-(2-fluoroethylamino)-3-[4-[2-[4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(C(CNCCF)Cc2ccc(C#Cc3ccc(CN4CCS(=O)CC4)cc3)cc2)c1O |
| InChI | InChI=1S/C28H31FN4O3S/c29-11-12-30-18-25(26-27(34)28(35)32-20-31-26)17-23-7-3-21(4-8-23)1-2-22-5-9-24(10-6-22)19-33-13-15-37(36)16-14-33/h3-10,20,25,30,34H,11-19H2,(H,31,32,35) |
| InChIKey | KMVHPZVMPJGQSX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|