About (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid
(6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid (PubChem CID 142471121) has the molecular formula C9H7BN2O3S
and a molecular weight of 234.04 g/mol. Its IUPAC name is (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid.
Molecular Properties
| Compound Name | (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid |
| PubChem CID | 142471121 |
| Molecular Formula | C9H7BN2O3S |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid |
| SMILES | COc1nc2c(B(O)O)csc2cc1C#N |
| InChI | InChI=1S/C9H7BN2O3S/c1-15-9-5(3-11)2-7-8(12-9)6(4-16-7)10(13)14/h2,4,13-14H,1H3 |
| InChIKey | PZAOVPMCEBLDLK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid?
The IUPAC name of (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid (CID 142471121) is (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid.
What is the SMILES notation for (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid?
The canonical SMILES for (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid is COc1nc2c(B(O)O)csc2cc1C#N.
What is the InChIKey of (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid?
The InChIKey is PZAOVPMCEBLDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BN2O3S/c1-15-9-5(3-11)2-7-8(12-9)6(4-16-7)10(13)14/h2,4,13-14H,1H3.
What are the key properties of (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid?
(6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid has a molecular weight of 234.04 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyano-5-methoxythieno[3,2-b]pyridin-3-yl)boronic acid is sourced from PubChem (CID 142471121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).