C17H23N3O2 — CID 142471422
tert-butyl N-[6-[1-(methylamino)ethyl]isoquinolin-1-yl]carbamate (PubChem CID 142471422) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl N-[6-[1-(methylamino)ethyl]isoquinolin-1-yl]carbamate.
| Compound Name | tert-butyl N-[6-[1-(methylamino)ethyl]isoquinolin-1-yl]carbamate |
|---|---|
| PubChem CID | 142471422 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl N-[6-[1-(methylamino)ethyl]isoquinolin-1-yl]carbamate |
| SMILES | CNC(C)c1ccc2c(NC(=O)OC(C)(C)C)nccc2c1 |
| InChI | InChI=1S/C17H23N3O2/c1-11(18-5)12-6-7-14-13(10-12)8-9-19-15(14)20-16(21)22-17(2,3)4/h6-11,18H,1-5H3,(H,19,20,21) |
| InChIKey | FRXWFPZXYPAONU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |