C16H25NO2 — CID 142471426
tert-butyl (2R)-2-[(3E)-4-methylhexa-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate (PubChem CID 142471426) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3E)-4-methylhexa-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3E)-4-methylhexa-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142471426 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | tert-butyl (2R)-2-[(3E)-4-methylhexa-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C/C(C)=C/C(=C)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO2/c1-7-12(2)11-13(3)14-9-8-10-17(14)15(18)19-16(4,5)6/h7,11,14H,1,3,8-10H2,2,4-6H3/b12-11+/t14-/m1/s1 |
| InChIKey | XYDZSSIFGQMSFN-GCZGRYASSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|