About 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile
4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile (PubChem CID 142471498) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile.
Molecular Properties
| Compound Name | 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile |
| PubChem CID | 142471498 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile |
| SMILES | COc1ccnc(N)c1.N#CN1CCCC1 |
| InChI | InChI=1S/C6H8N2O.C5H8N2/c1-9-5-2-3-8-6(7)4-5;6-5-7-3-1-2-4-7/h2-4H,1H3,(H2,7,8);1-4H2 |
| InChIKey | BBBCKFFAXOVWSI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile?
The IUPAC name of 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile (CID 142471498) is 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile.
What is the SMILES notation for 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile?
The canonical SMILES for 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile is COc1ccnc(N)c1.N#CN1CCCC1.
What is the InChIKey of 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile?
The InChIKey is BBBCKFFAXOVWSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.C5H8N2/c1-9-5-2-3-8-6(7)4-5;6-5-7-3-1-2-4-7/h2-4H,1H3,(H2,7,8);1-4H2.
What are the key properties of 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile?
4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile has a molecular weight of 220.28 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypyridin-2-amine;pyrrolidine-1-carbonitrile is sourced from PubChem (CID 142471498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).