C21H21N5S — CID 142471796
3-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-5-phenyl-1,2,4-triazole (PubChem CID 142471796) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-5-phenyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 142471796 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-5-phenyl-1,2,4-triazole |
| SMILES | c1ccc(CSc2nnc(-c3ccccc3)n2CCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C21H21N5S/c1-3-8-17(9-4-1)15-27-21-25-24-20(18-10-5-2-6-11-18)26(21)13-7-12-19-14-22-16-23-19/h1-6,8-11,14,16H,7,12-13,15H2,(H,22,23) |
| InChIKey | JMIBNXZNMNUJAQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |