C46H41F3N6 — CID 142471835
1-methyl-3-[2-[5-[[3-(trifluoromethyl)phenyl]methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]indole (PubChem CID 142471835) has the molecular formula C46H41F3N6 and a molecular weight of 734.87 g/mol. Its IUPAC name is 1-methyl-3-[2-[5-[[3-(trifluoromethyl)phenyl]methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]indole.
| Compound Name | 1-methyl-3-[2-[5-[[3-(trifluoromethyl)phenyl]methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]indole |
|---|---|
| PubChem CID | 142471835 |
| Molecular Formula | C46H41F3N6 |
| Molecular Weight | 734.87 g/mol |
| Exact Mass | 734.33 |
| IUPAC Name | 1-methyl-3-[2-[5-[[3-(trifluoromethyl)phenyl]methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]indole |
| SMILES | Cn1cc(CCc2nnc(Cc3cccc(C(F)(F)F)c3)n2CCCc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c2ccccc21 |
| InChI | InChI=1S/C46H41F3N6/c1-53-31-35(41-24-11-12-25-42(41)53)26-27-43-51-52-44(30-34-15-13-22-39(29-34)46(47,48)49)55(43)28-14-23-40-32-54(33-50-40)45(36-16-5-2-6-17-36,37-18-7-3-8-19-37)38-20-9-4-10-21-38/h2-13,15-22,24-25,29,31-33H,14,23,26-28,30H2,1H3 |
| InChIKey | MQFNFDZHXKRDCW-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.87 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|