C45H37F2N7 — CID 142471870
6-fluoro-3-[[5-[(6-fluoro-1H-indol-3-yl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-1H-indole (PubChem CID 142471870) has the molecular formula C45H37F2N7 and a molecular weight of 713.84 g/mol. Its IUPAC name is 6-fluoro-3-[[5-[(6-fluoro-1H-indol-3-yl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-1H-indole.
| Compound Name | 6-fluoro-3-[[5-[(6-fluoro-1H-indol-3-yl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 142471870 |
| Molecular Formula | C45H37F2N7 |
| Molecular Weight | 713.84 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 6-fluoro-3-[[5-[(6-fluoro-1H-indol-3-yl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-1H-indole |
| SMILES | Fc1ccc2c(Cc3nnc(Cc4c[nH]c5cc(F)ccc45)n3CCCc3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)c[nH]c2c1 |
| InChI | InChI=1S/C45H37F2N7/c46-36-18-20-39-31(27-48-41(39)25-36)23-43-51-52-44(24-32-28-49-42-26-37(47)19-21-40(32)42)54(43)22-10-17-38-29-53(30-50-38)45(33-11-4-1-5-12-33,34-13-6-2-7-14-34)35-15-8-3-9-16-35/h1-9,11-16,18-21,25-30,48-49H,10,17,22-24H2 |
| InChIKey | LOPHAYMJAJIUNA-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.84 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|