C44H39FN6O — CID 142471937
3-[[5-[(4-fluorophenyl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-5-methoxy-1H-indole (PubChem CID 142471937) has the molecular formula C44H39FN6O and a molecular weight of 686.84 g/mol. Its IUPAC name is 3-[[5-[(4-fluorophenyl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-5-methoxy-1H-indole.
| Compound Name | 3-[[5-[(4-fluorophenyl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 142471937 |
| Molecular Formula | C44H39FN6O |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 3-[[5-[(4-fluorophenyl)methyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(Cc3nnc(Cc4ccc(F)cc4)n3CCCc3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)c2c1 |
| InChI | InChI=1S/C44H39FN6O/c1-52-39-23-24-41-40(28-39)33(29-46-41)27-43-49-48-42(26-32-19-21-37(45)22-20-32)51(43)25-11-18-38-30-50(31-47-38)44(34-12-5-2-6-13-34,35-14-7-3-8-15-35)36-16-9-4-10-17-36/h2-10,12-17,19-24,28-31,46H,11,18,25-27H2,1H3 |
| InChIKey | JBSBVSKVUAEXDX-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|