C22H23N5S — CID 142471947
3-benzyl-5-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-1,2,4-triazole (PubChem CID 142471947) has the molecular formula C22H23N5S and a molecular weight of 389.53 g/mol. Its IUPAC name is 3-benzyl-5-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-1,2,4-triazole.
| Compound Name | 3-benzyl-5-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 142471947 |
| Molecular Formula | C22H23N5S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-benzyl-5-benzylsulfanyl-4-[3-(1H-imidazol-5-yl)propyl]-1,2,4-triazole |
| SMILES | c1ccc(CSc2nnc(Cc3ccccc3)n2CCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C22H23N5S/c1-3-8-18(9-4-1)14-21-25-26-22(28-16-19-10-5-2-6-11-19)27(21)13-7-12-20-15-23-17-24-20/h1-6,8-11,15,17H,7,12-14,16H2,(H,23,24) |
| InChIKey | UUHUEWYWPKZLBJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |