About ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide
ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide (PubChem CID 142472764) has the molecular formula C9H16N2O2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide.
Molecular Properties
| Compound Name | ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide |
| PubChem CID | 142472764 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide |
| SMILES | CC.CCOc1ccsc1/C(N)=N/O |
| InChI | InChI=1S/C7H10N2O2S.C2H6/c1-2-11-5-3-4-12-6(5)7(8)9-10;1-2/h3-4,10H,2H2,1H3,(H2,8,9);1-2H3 |
| InChIKey | CEZDZZTZLJLPQD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide?
The IUPAC name of ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide (CID 142472764) is ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide.
What is the SMILES notation for ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide?
The canonical SMILES for ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide is CC.CCOc1ccsc1/C(N)=N/O.
What is the InChIKey of ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide?
The InChIKey is CEZDZZTZLJLPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S.C2H6/c1-2-11-5-3-4-12-6(5)7(8)9-10;1-2/h3-4,10H,2H2,1H3,(H2,8,9);1-2H3.
What are the key properties of ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide?
ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide has a molecular weight of 216.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethoxy-N'-hydroxythiophene-2-carboximidamide is sourced from PubChem (CID 142472764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).