2-ethoxy-6-propylbenzoic acid

C12H16O3 — CID 142472864

IUPAC2-ethoxy-6-propylbenzoic acid
SMILESCCCc1cccc(OCC)c1C(=O)O
InChIInChI=1S/C12H16O3/c1-3-6-9-7-5-8-10(15-4-2)11(9)12(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14)
InChIKeyMZRAGDCSXARSDE-UHFFFAOYSA-N
MW208.26 g/mol
LogP2.74
Rot. Bonds5

About 2-ethoxy-6-propylbenzoic acid

2-ethoxy-6-propylbenzoic acid (PubChem CID 142472864) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-ethoxy-6-propylbenzoic acid.

Molecular Properties

Compound Name2-ethoxy-6-propylbenzoic acid
PubChem CID142472864
Molecular FormulaC12H16O3
Molecular Weight208.26 g/mol
Exact Mass208.11
IUPAC Name2-ethoxy-6-propylbenzoic acid
SMILESCCCc1cccc(OCC)c1C(=O)O
InChIInChI=1S/C12H16O3/c1-3-6-9-7-5-8-10(15-4-2)11(9)12(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14)
InChIKeyMZRAGDCSXARSDE-UHFFFAOYSA-N
XLogP2.74
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-ethoxy-6-propylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-6-propylbenzoic acid?
The IUPAC name of 2-ethoxy-6-propylbenzoic acid (CID 142472864) is 2-ethoxy-6-propylbenzoic acid.
What is the SMILES notation for 2-ethoxy-6-propylbenzoic acid?
The canonical SMILES for 2-ethoxy-6-propylbenzoic acid is CCCc1cccc(OCC)c1C(=O)O.
What is the InChIKey of 2-ethoxy-6-propylbenzoic acid?
The InChIKey is MZRAGDCSXARSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-6-9-7-5-8-10(15-4-2)11(9)12(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14).
What are the key properties of 2-ethoxy-6-propylbenzoic acid?
2-ethoxy-6-propylbenzoic acid has a molecular weight of 208.26 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-propylbenzoic acid is sourced from PubChem (CID 142472864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).