About 2-ethoxy-6-propylbenzoic acid
2-ethoxy-6-propylbenzoic acid (PubChem CID 142472864) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-ethoxy-6-propylbenzoic acid.
Molecular Properties
| Compound Name | 2-ethoxy-6-propylbenzoic acid |
| PubChem CID | 142472864 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-ethoxy-6-propylbenzoic acid |
| SMILES | CCCc1cccc(OCC)c1C(=O)O |
| InChI | InChI=1S/C12H16O3/c1-3-6-9-7-5-8-10(15-4-2)11(9)12(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | MZRAGDCSXARSDE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-6-propylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-propylbenzoic acid?
The IUPAC name of 2-ethoxy-6-propylbenzoic acid (CID 142472864) is 2-ethoxy-6-propylbenzoic acid.
What is the SMILES notation for 2-ethoxy-6-propylbenzoic acid?
The canonical SMILES for 2-ethoxy-6-propylbenzoic acid is CCCc1cccc(OCC)c1C(=O)O.
What is the InChIKey of 2-ethoxy-6-propylbenzoic acid?
The InChIKey is MZRAGDCSXARSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-6-9-7-5-8-10(15-4-2)11(9)12(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14).
What are the key properties of 2-ethoxy-6-propylbenzoic acid?
2-ethoxy-6-propylbenzoic acid has a molecular weight of 208.26 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-propylbenzoic acid is sourced from PubChem (CID 142472864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).