C12H15NO2 — CID 142473164
ethane;5-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-1,2-oxazol-3-one (PubChem CID 142473164) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is ethane;5-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-1,2-oxazol-3-one.
| Compound Name | ethane;5-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 142473164 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethane;5-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-1,2-oxazol-3-one |
| SMILES | C#C/C=C\C=C(/C)c1cc(=O)[nH]o1.CC |
| InChI | InChI=1S/C10H9NO2.C2H6/c1-3-4-5-6-8(2)9-7-10(12)11-13-9;1-2/h1,4-7H,2H3,(H,11,12);1-2H3/b5-4-,8-6+; |
| InChIKey | HZMQSYZPDZKQNG-NLAQHMENSA-N |
| XLogP | 2.59 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|