C19H30N2O4 — CID 142473215
(2E)-3-cyclopropyl-2-(methylamino)penta-2,4-dienoic acid;ethane;1-propylpyrrole-2-carboxylic acid (PubChem CID 142473215) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2E)-3-cyclopropyl-2-(methylamino)penta-2,4-dienoic acid;ethane;1-propylpyrrole-2-carboxylic acid.
| Compound Name | (2E)-3-cyclopropyl-2-(methylamino)penta-2,4-dienoic acid;ethane;1-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 142473215 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2E)-3-cyclopropyl-2-(methylamino)penta-2,4-dienoic acid;ethane;1-propylpyrrole-2-carboxylic acid |
| SMILES | C=C/C(=C(\NC)C(=O)O)C1CC1.CC.CCCn1cccc1C(=O)O |
| InChI | InChI=1S/C9H13NO2.C8H11NO2.C2H6/c1-3-7(6-4-5-6)8(10-2)9(11)12;1-2-5-9-6-3-4-7(9)8(10)11;1-2/h3,6,10H,1,4-5H2,2H3,(H,11,12);3-4,6H,2,5H2,1H3,(H,10,11);1-2H3/b8-7+;; |
| InChIKey | HSSWRKOSDWTVTF-MIIBGCIDSA-N |
| XLogP | 3.76 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|