C12H28N2O — CID 142473425
N,N-dimethylmethanamine;ethane;4-methylpiperidine-1-carbaldehyde (PubChem CID 142473425) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;4-methylpiperidine-1-carbaldehyde.
| Compound Name | N,N-dimethylmethanamine;ethane;4-methylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 142473425 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;4-methylpiperidine-1-carbaldehyde |
| SMILES | CC.CC1CCN(C=O)CC1.CN(C)C |
| InChI | InChI=1S/C7H13NO.C3H9N.C2H6/c1-7-2-4-8(6-9)5-3-7;1-4(2)3;1-2/h6-7H,2-5H2,1H3;1-3H3;1-2H3 |
| InChIKey | QTAOKVNCFJVMGU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|