C35H44N6O3 — CID 142473607
N-[[2-[[3-(dimethylamino)propylamino]methyl]phenyl]methyl]-2,2-dimethyl-N-[2-oxo-2-[(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)amino]ethyl]propanamide (PubChem CID 142473607) has the molecular formula C35H44N6O3 and a molecular weight of 596.78 g/mol. Its IUPAC name is N-[[2-[[3-(dimethylamino)propylamino]methyl]phenyl]methyl]-2,2-dimethyl-N-[2-oxo-2-[(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)amino]ethyl]propanamide.
| Compound Name | N-[[2-[[3-(dimethylamino)propylamino]methyl]phenyl]methyl]-2,2-dimethyl-N-[2-oxo-2-[(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 142473607 |
| Molecular Formula | C35H44N6O3 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | N-[[2-[[3-(dimethylamino)propylamino]methyl]phenyl]methyl]-2,2-dimethyl-N-[2-oxo-2-[(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)amino]ethyl]propanamide |
| SMILES | CN(C)CCCNCc1ccccc1CN(CC(=O)Nc1ccc2c(c1)CC1(C2)C(=O)Nc2ncccc21)C(=O)C(C)(C)C |
| InChI | InChI=1S/C35H44N6O3/c1-34(2,3)33(44)41(22-26-11-7-6-10-25(26)21-36-15-9-17-40(4)5)23-30(42)38-28-14-13-24-19-35(20-27(24)18-28)29-12-8-16-37-31(29)39-32(35)43/h6-8,10-14,16,18,36H,9,15,17,19-23H2,1-5H3,(H,38,42)(H,37,39,43) |
| InChIKey | WTJHGZQOWBLBAJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|