C17H16 — CID 142474091
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]naphthalene (PubChem CID 142474091) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]naphthalene.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]naphthalene |
|---|---|
| PubChem CID | 142474091 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]naphthalene |
| SMILES | C=C/C=C(\C=C/C)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H16/c1-3-8-14(9-4-2)17-13-7-11-15-10-5-6-12-16(15)17/h3-13H,1H2,2H3/b9-4-,14-8+ |
| InChIKey | GUXFOMRRVPESJU-MPIKLPQRSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|