C17H23NO — CID 142474567
1-(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)ethanone (PubChem CID 142474567) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)ethanone.
| Compound Name | 1-(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)ethanone |
|---|---|
| PubChem CID | 142474567 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)ethanone |
| SMILES | CC(=O)C1CCCC2(C)c3cc(N)ccc3CCC12 |
| InChI | InChI=1S/C17H23NO/c1-11(19)14-4-3-9-17(2)15(14)8-6-12-5-7-13(18)10-16(12)17/h5,7,10,14-15H,3-4,6,8-9,18H2,1-2H3 |
| InChIKey | NYDUTTCAYBUOSM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|