About 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine
3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine (PubChem CID 142474678) has the molecular formula C10H12F2N2S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine |
| PubChem CID | 142474678 |
| Molecular Formula | C10H12F2N2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine |
| SMILES | CC(F)(F)c1csc(C23CC(N)(C2)C3)n1 |
| InChI | InChI=1S/C10H12F2N2S/c1-8(11,12)6-2-15-7(14-6)9-3-10(13,4-9)5-9/h2H,3-5,13H2,1H3 |
| InChIKey | RDPYVZKZESEMJL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine?
The IUPAC name of 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine (CID 142474678) is 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine.
What is the SMILES notation for 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine?
The canonical SMILES for 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine is CC(F)(F)c1csc(C23CC(N)(C2)C3)n1.
What is the InChIKey of 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine?
The InChIKey is RDPYVZKZESEMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2S/c1-8(11,12)6-2-15-7(14-6)9-3-10(13,4-9)5-9/h2H,3-5,13H2,1H3.
What are the key properties of 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine?
3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine has a molecular weight of 230.28 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,1-difluoroethyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentan-1-amine is sourced from PubChem (CID 142474678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).