About 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine
1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine (PubChem CID 142475064) has the molecular formula C20H30FN
and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine.
Molecular Properties
| Compound Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine |
| PubChem CID | 142475064 |
| Molecular Formula | C20H30FN |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C20H30FN/c1-16(2)14-19(22-12-6-5-7-13-22)15-20(3,4)17-8-10-18(21)11-9-17/h8-11,14,19H,5-7,12-13,15H2,1-4H3 |
| InChIKey | FWGSRIPUTIXFAZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine?
The IUPAC name of 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine (CID 142475064) is 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine.
What is the SMILES notation for 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine?
The canonical SMILES for 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine is CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCCCC1.
What is the InChIKey of 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine?
The InChIKey is FWGSRIPUTIXFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30FN/c1-16(2)14-19(22-12-6-5-7-13-22)15-20(3,4)17-8-10-18(21)11-9-17/h8-11,14,19H,5-7,12-13,15H2,1-4H3.
What are the key properties of 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine?
1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine has a molecular weight of 303.47 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidine is sourced from PubChem (CID 142475064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).