About 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate
2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate (PubChem CID 142475075) has the molecular formula C24H37FN2O2
and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate |
| PubChem CID | 142475075 |
| Molecular Formula | C24H37FN2O2 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCN(C(=O)OCC(C)C)CC1 |
| InChI | InChI=1S/C24H37FN2O2/c1-18(2)15-22(16-24(5,6)20-7-9-21(25)10-8-20)26-11-13-27(14-12-26)23(28)29-17-19(3)4/h7-10,15,19,22H,11-14,16-17H2,1-6H3 |
| InChIKey | VCJPUHBRKFMWIH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate (CID 142475075) is 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate is CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCN(C(=O)OCC(C)C)CC1.
What is the InChIKey of 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate?
The InChIKey is VCJPUHBRKFMWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37FN2O2/c1-18(2)15-22(16-24(5,6)20-7-9-21(25)10-8-20)26-11-13-27(14-12-26)23(28)29-17-19(3)4/h7-10,15,19,22H,11-14,16-17H2,1-6H3.
What are the key properties of 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate?
2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate has a molecular weight of 404.57 g/mol, XLogP of 5.24, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazine-1-carboxylate is sourced from PubChem (CID 142475075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).