About 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol
1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol (PubChem CID 142475176) has the molecular formula C20H30ClNO
and a molecular weight of 335.92 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol |
| PubChem CID | 142475176 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H30ClNO/c1-15(2)13-18(22-11-9-19(23)10-12-22)14-20(3,4)16-5-7-17(21)8-6-16/h5-8,13,18-19,23H,9-12,14H2,1-4H3 |
| InChIKey | SOXMTDVYACOYHH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol?
The IUPAC name of 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol (CID 142475176) is 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol.
What is the SMILES notation for 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol?
The canonical SMILES for 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol is CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC(O)CC1.
What is the InChIKey of 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol?
The InChIKey is SOXMTDVYACOYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30ClNO/c1-15(2)13-18(22-11-9-19(23)10-12-22)14-20(3,4)16-5-7-17(21)8-6-16/h5-8,13,18-19,23H,9-12,14H2,1-4H3.
What are the key properties of 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol?
1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol has a molecular weight of 335.92 g/mol, XLogP of 4.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]piperidin-4-ol is sourced from PubChem (CID 142475176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).