About 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine
1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine (PubChem CID 142475187) has the molecular formula C26H38F3NO
and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine.
Molecular Properties
| Compound Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine |
| PubChem CID | 142475187 |
| Molecular Formula | C26H38F3NO |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(C(F)(F)F)cc1)N1CCC(C2CCOCC2)CC1 |
| InChI | InChI=1S/C26H38F3NO/c1-19(2)17-24(30-13-9-20(10-14-30)21-11-15-31-16-12-21)18-25(3,4)22-5-7-23(8-6-22)26(27,28)29/h5-8,17,20-21,24H,9-16,18H2,1-4H3 |
| InChIKey | LLSXEASYIOQRQU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine?
The IUPAC name of 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine (CID 142475187) is 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine.
What is the SMILES notation for 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine?
The canonical SMILES for 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine is CC(C)=CC(CC(C)(C)c1ccc(C(F)(F)F)cc1)N1CCC(C2CCOCC2)CC1.
What is the InChIKey of 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine?
The InChIKey is LLSXEASYIOQRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38F3NO/c1-19(2)17-24(30-13-9-20(10-14-30)21-11-15-31-16-12-21)18-25(3,4)22-5-7-23(8-6-22)26(27,28)29/h5-8,17,20-21,24H,9-16,18H2,1-4H3.
What are the key properties of 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine?
1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine has a molecular weight of 437.59 g/mol, XLogP of 6.85, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-(oxan-4-yl)piperidine is sourced from PubChem (CID 142475187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).