About ethane;4-(oxan-4-yl)piperidine
ethane;4-(oxan-4-yl)piperidine (PubChem CID 142475221) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;4-(oxan-4-yl)piperidine.
Molecular Properties
| Compound Name | ethane;4-(oxan-4-yl)piperidine |
| PubChem CID | 142475221 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;4-(oxan-4-yl)piperidine |
| SMILES | C1CC(C2CCOCC2)CCN1.CC |
| InChI | InChI=1S/C10H19NO.C2H6/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2/h9-11H,1-8H2;1-2H3 |
| InChIKey | CSSZURGPDFVDCP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(oxan-4-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(oxan-4-yl)piperidine?
The IUPAC name of ethane;4-(oxan-4-yl)piperidine (CID 142475221) is ethane;4-(oxan-4-yl)piperidine.
What is the SMILES notation for ethane;4-(oxan-4-yl)piperidine?
The canonical SMILES for ethane;4-(oxan-4-yl)piperidine is C1CC(C2CCOCC2)CCN1.CC.
What is the InChIKey of ethane;4-(oxan-4-yl)piperidine?
The InChIKey is CSSZURGPDFVDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C2H6/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2/h9-11H,1-8H2;1-2H3.
What are the key properties of ethane;4-(oxan-4-yl)piperidine?
ethane;4-(oxan-4-yl)piperidine has a molecular weight of 199.34 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(oxan-4-yl)piperidine is sourced from PubChem (CID 142475221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).