C26H40FNO2 — CID 142475280
1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-[2-(oxolan-3-yloxy)ethyl]piperidine (PubChem CID 142475280) has the molecular formula C26H40FNO2 and a molecular weight of 417.61 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-[2-(oxolan-3-yloxy)ethyl]piperidine.
| Compound Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-[2-(oxolan-3-yloxy)ethyl]piperidine |
|---|---|
| PubChem CID | 142475280 |
| Molecular Formula | C26H40FNO2 |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-[2-(oxolan-3-yloxy)ethyl]piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCC(CCOC2CCOC2)CC1 |
| InChI | InChI=1S/C26H40FNO2/c1-20(2)17-24(18-26(3,4)22-5-7-23(27)8-6-22)28-13-9-21(10-14-28)11-16-30-25-12-15-29-19-25/h5-8,17,21,24-25H,9-16,18-19H2,1-4H3 |
| InChIKey | UVYNAWSOFNDSGB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|