About 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine]
1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 142475297) has the molecular formula C27H34ClNO
and a molecular weight of 424.03 g/mol. Its IUPAC name is 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| PubChem CID | 142475297 |
| Molecular Formula | C27H34ClNO |
| Molecular Weight | 424.03 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C27H34ClNO/c1-20(2)17-24(18-26(3,4)22-9-11-23(28)12-10-22)29-15-13-27(14-16-29)25-8-6-5-7-21(25)19-30-27/h5-12,17,24H,13-16,18-19H2,1-4H3 |
| InChIKey | CVOSGQBLMHWSCK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.03 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine]?
The IUPAC name of 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] (CID 142475297) is 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine].
What is the SMILES notation for 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine]?
The canonical SMILES for 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] is CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC2(CC1)OCc1ccccc12.
What is the InChIKey of 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine]?
The InChIKey is CVOSGQBLMHWSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34ClNO/c1-20(2)17-24(18-26(3,4)22-9-11-23(28)12-10-22)29-15-13-27(14-16-29)25-8-6-5-7-21(25)19-30-27/h5-12,17,24H,13-16,18-19H2,1-4H3.
What are the key properties of 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine]?
1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] has a molecular weight of 424.03 g/mol, XLogP of 6.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]spiro[1H-2-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 142475297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).