About 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane
9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 142475307) has the molecular formula C25H39NO3S
and a molecular weight of 433.66 g/mol. Its IUPAC name is 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| PubChem CID | 142475307 |
| Molecular Formula | C25H39NO3S |
| Molecular Weight | 433.66 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(S(C)(=O)=O)cc1)N1CCC2(CCOCC2)CC1 |
| InChI | InChI=1S/C25H39NO3S/c1-20(2)18-22(26-14-10-25(11-15-26)12-16-29-17-13-25)19-24(3,4)21-6-8-23(9-7-21)30(5,27)28/h6-9,18,22H,10-17,19H2,1-5H3 |
| InChIKey | GRSPUBSDRLPYGS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The IUPAC name of 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane (CID 142475307) is 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
What is the SMILES notation for 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The canonical SMILES for 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane is CC(C)=CC(CC(C)(C)c1ccc(S(C)(=O)=O)cc1)N1CCC2(CCOCC2)CC1.
What is the InChIKey of 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The InChIKey is GRSPUBSDRLPYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H39NO3S/c1-20(2)18-22(26-14-10-25(11-15-26)12-16-29-17-13-25)19-24(3,4)21-6-8-23(9-7-21)30(5,27)28/h6-9,18,22H,10-17,19H2,1-5H3.
What are the key properties of 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane has a molecular weight of 433.66 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,6-dimethyl-6-(4-methylsulfonylphenyl)hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane is sourced from PubChem (CID 142475307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).