C24H36F3NO — CID 142475328
1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-propan-2-yloxypiperidine (PubChem CID 142475328) has the molecular formula C24H36F3NO and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-propan-2-yloxypiperidine.
| Compound Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-propan-2-yloxypiperidine |
|---|---|
| PubChem CID | 142475328 |
| Molecular Formula | C24H36F3NO |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-propan-2-yloxypiperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(C(F)(F)F)cc1)N1CCC(OC(C)C)CC1 |
| InChI | InChI=1S/C24H36F3NO/c1-17(2)15-21(28-13-11-22(12-14-28)29-18(3)4)16-23(5,6)19-7-9-20(10-8-19)24(25,26)27/h7-10,15,18,21-22H,11-14,16H2,1-6H3 |
| InChIKey | BCVHWXMQMYXFMG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|