C32H39FN4O2 — CID 142475529
CID 142475529 (PubChem CID 142475529) has the molecular formula C32H39FN4O2 and a molecular weight of 530.69 g/mol.
| Compound Name | CID 142475529 |
|---|---|
| PubChem CID | 142475529 |
| Molecular Formula | C32H39FN4O2 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | — |
| SMILES | COc1ccc2c3c([nH]c2c1)C1(CCNCC1)N(Cc1ccccc1F)CC31CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C32H39FN4O2/c1-39-24-9-10-25-27(19-24)35-29-28(25)31(13-17-36(18-14-31)30(38)22-6-4-7-22)21-37(32(29)11-15-34-16-12-32)20-23-5-2-3-8-26(23)33/h2-3,5,8-10,19,22,34-35H,4,6-7,11-18,20-21H2,1H3 |
| InChIKey | CSECHSSERIHRIW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |