About (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one
(6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one (PubChem CID 142475675) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one.
Molecular Properties
| Compound Name | (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one |
| PubChem CID | 142475675 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one |
| SMILES | C[C@@]12CCCC=C1C1(C2)OC2=CCCC=C2C1=O |
| InChI | InChI=1S/C16H18O2/c1-15-9-5-4-8-13(15)16(10-15)14(17)11-6-2-3-7-12(11)18-16/h6-8H,2-5,9-10H2,1H3/t15-,16?/m0/s1 |
| InChIKey | ODLSFFBCCFFBOT-VYRBHSGPSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one?
The IUPAC name of (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one (CID 142475675) is (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one.
What is the SMILES notation for (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one?
The canonical SMILES for (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one is C[C@@]12CCCC=C1C1(C2)OC2=CCCC=C2C1=O.
What is the InChIKey of (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one?
The InChIKey is ODLSFFBCCFFBOT-VYRBHSGPSA-N. The full InChI is InChI=1S/C16H18O2/c1-15-9-5-4-8-13(15)16(10-15)14(17)11-6-2-3-7-12(11)18-16/h6-8H,2-5,9-10H2,1H3/t15-,16?/m0/s1.
What are the key properties of (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one?
(6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one has a molecular weight of 242.32 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6'S)-6'-methylspiro[5,6-dihydro-1-benzofuran-2,8'-bicyclo[4.2.0]oct-1-ene]-3-one is sourced from PubChem (CID 142475675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).