C11H11FN4O2 — CID 142475916
1-(4-cyanopyrimidin-2-yl)-4-fluoropiperidine-4-carboxylic acid (PubChem CID 142475916) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is 1-(4-cyanopyrimidin-2-yl)-4-fluoropiperidine-4-carboxylic acid.
| Compound Name | 1-(4-cyanopyrimidin-2-yl)-4-fluoropiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142475916 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-(4-cyanopyrimidin-2-yl)-4-fluoropiperidine-4-carboxylic acid |
| SMILES | N#Cc1ccnc(N2CCC(F)(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C11H11FN4O2/c12-11(9(17)18)2-5-16(6-3-11)10-14-4-1-8(7-13)15-10/h1,4H,2-3,5-6H2,(H,17,18) |
| InChIKey | GXZXHSHAXHWFGR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |