C11H12ClF2N3O — CID 142475962
(3S)-3-fluoro-1-(5-fluoropyrimidin-2-yl)-4-methylpiperidine-4-carbonyl chloride (PubChem CID 142475962) has the molecular formula C11H12ClF2N3O and a molecular weight of 275.69 g/mol. Its IUPAC name is (3S)-3-fluoro-1-(5-fluoropyrimidin-2-yl)-4-methylpiperidine-4-carbonyl chloride.
| Compound Name | (3S)-3-fluoro-1-(5-fluoropyrimidin-2-yl)-4-methylpiperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 142475962 |
| Molecular Formula | C11H12ClF2N3O |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (3S)-3-fluoro-1-(5-fluoropyrimidin-2-yl)-4-methylpiperidine-4-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)CCN(c2ncc(F)cn2)C[C@H]1F |
| InChI | InChI=1S/C11H12ClF2N3O/c1-11(9(12)18)2-3-17(6-8(11)14)10-15-4-7(13)5-16-10/h4-5,8H,2-3,6H2,1H3/t8-,11?/m1/s1 |
| InChIKey | ALXCKBSJMUMCIA-RZZZFEHKSA-N |
| XLogP | 1.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|