C19H18F3N7O2 — CID 142476069
[3,3-difluoro-1-([1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]-(9-fluoro-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl)methanone (PubChem CID 142476069) has the molecular formula C19H18F3N7O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is [3,3-difluoro-1-([1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]-(9-fluoro-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl)methanone.
| Compound Name | [3,3-difluoro-1-([1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]-(9-fluoro-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl)methanone |
|---|---|
| PubChem CID | 142476069 |
| Molecular Formula | C19H18F3N7O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [3,3-difluoro-1-([1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]-(9-fluoro-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl)methanone |
| SMILES | O=C(C1CCN(c2nccc3ncnn23)CC1(F)F)N1CCOc2c(F)cncc2C1 |
| InChI | InChI=1S/C19H18F3N7O2/c20-14-8-23-7-12-9-27(5-6-31-16(12)14)17(30)13-2-4-28(10-19(13,21)22)18-24-3-1-15-25-11-26-29(15)18/h1,3,7-8,11,13H,2,4-6,9-10H2 |
| InChIKey | WKBLUZGQJOLKID-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |