About 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane
4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane (PubChem CID 142476251) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane.
Molecular Properties
| Compound Name | 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane |
| PubChem CID | 142476251 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane |
| SMILES | CCC.CSc1nc(O)c(C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2S.C3H8/c1-4(2)5-6(11)9-8(13-3)10-7(5)12;1-3-2/h4H,1-3H3,(H2,9,10,11,12);3H2,1-2H3 |
| InChIKey | PLOHZNMJWOGNGF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane?
The IUPAC name of 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane (CID 142476251) is 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane.
What is the SMILES notation for 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane?
The canonical SMILES for 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane is CCC.CSc1nc(O)c(C(C)C)c(=O)[nH]1.
What is the InChIKey of 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane?
The InChIKey is PLOHZNMJWOGNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S.C3H8/c1-4(2)5-6(11)9-8(13-3)10-7(5)12;1-3-2/h4H,1-3H3,(H2,9,10,11,12);3H2,1-2H3.
What are the key properties of 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane?
4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane has a molecular weight of 244.36 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one;propane is sourced from PubChem (CID 142476251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).