C13H22N2O2 — CID 142476326
ethane;N-ethyl-2,4,5-trimethyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 142476326) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;N-ethyl-2,4,5-trimethyl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | ethane;N-ethyl-2,4,5-trimethyl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142476326 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;N-ethyl-2,4,5-trimethyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC.CCNC(=O)c1c(C)[nH]c(=O)c(C)c1C |
| InChI | InChI=1S/C11H16N2O2.C2H6/c1-5-12-11(15)9-6(2)7(3)10(14)13-8(9)4;1-2/h5H2,1-4H3,(H,12,15)(H,13,14);1-2H3 |
| InChIKey | KLWGMYRFADPIQT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |