C15H30N2O2 — CID 142477708
N-[5-(ethylamino)-3,3,5-trimethyl-1-oxohexan-2-yl]butanamide (PubChem CID 142477708) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[5-(ethylamino)-3,3,5-trimethyl-1-oxohexan-2-yl]butanamide.
| Compound Name | N-[5-(ethylamino)-3,3,5-trimethyl-1-oxohexan-2-yl]butanamide |
|---|---|
| PubChem CID | 142477708 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N-[5-(ethylamino)-3,3,5-trimethyl-1-oxohexan-2-yl]butanamide |
| SMILES | CCCC(=O)NC(C=O)C(C)(C)CC(C)(C)NCC |
| InChI | InChI=1S/C15H30N2O2/c1-7-9-13(19)17-12(10-18)14(3,4)11-15(5,6)16-8-2/h10,12,16H,7-9,11H2,1-6H3,(H,17,19) |
| InChIKey | DBYMJBWSEVTWID-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|