About N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide
N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide (PubChem CID 142478509) has the molecular formula C18H17Cl2N5
and a molecular weight of 374.28 g/mol. Its IUPAC name is N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide.
Molecular Properties
| Compound Name | N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide |
| PubChem CID | 142478509 |
| Molecular Formula | C18H17Cl2N5 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide |
| SMILES | Cc1c(-c2ccccc2)[nH]c(/C(=N/N)NN)c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5/c1-10-15(12-7-13(19)9-14(20)8-12)17(18(24-21)25-22)23-16(10)11-5-3-2-4-6-11/h2-9,23H,21-22H2,1H3,(H,24,25) |
| InChIKey | HCYGBNXZOQSCAR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide?
The IUPAC name of N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide (CID 142478509) is N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide.
What is the SMILES notation for N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide?
The canonical SMILES for N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide is Cc1c(-c2ccccc2)[nH]c(/C(=N/N)NN)c1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide?
The InChIKey is HCYGBNXZOQSCAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N5/c1-10-15(12-7-13(19)9-14(20)8-12)17(18(24-21)25-22)23-16(10)11-5-3-2-4-6-11/h2-9,23H,21-22H2,1H3,(H,24,25).
What are the key properties of N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide?
N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide has a molecular weight of 374.28 g/mol, XLogP of 4.05, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diamino-3-(3,5-dichlorophenyl)-4-methyl-5-phenyl-1H-pyrrole-2-carboximidamide is sourced from PubChem (CID 142478509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).