About 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one
6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one (PubChem CID 142478651) has the molecular formula C17H26ClN3O3
and a molecular weight of 355.87 g/mol. Its IUPAC name is 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one.
Molecular Properties
| Compound Name | 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one |
| PubChem CID | 142478651 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one |
| SMILES | CC(C)(O)CCn1c(=O)n(CCC(C)(C)O)c2c(Cl)cc(N)cc21 |
| InChI | InChI=1S/C17H26ClN3O3/c1-16(2,23)5-7-20-13-10-11(19)9-12(18)14(13)21(15(20)22)8-6-17(3,4)24/h9-10,23-24H,5-8,19H2,1-4H3 |
| InChIKey | VKJGESLLIKYKDR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one?
The IUPAC name of 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one (CID 142478651) is 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one.
What is the SMILES notation for 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one?
The canonical SMILES for 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one is CC(C)(O)CCn1c(=O)n(CCC(C)(C)O)c2c(Cl)cc(N)cc21.
What is the InChIKey of 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one?
The InChIKey is VKJGESLLIKYKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClN3O3/c1-16(2,23)5-7-20-13-10-11(19)9-12(18)14(13)21(15(20)22)8-6-17(3,4)24/h9-10,23-24H,5-8,19H2,1-4H3.
What are the key properties of 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one?
6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one has a molecular weight of 355.87 g/mol, XLogP of 2.36, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-chloro-1,3-bis(3-hydroxy-3-methylbutyl)benzimidazol-2-one is sourced from PubChem (CID 142478651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).