C27H35N5O4 — CID 142479000
ethyl 4-[4-(hydrazinylmethyl)-2-[2-[3-methyl-6-(methylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoate (PubChem CID 142479000) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 4-[4-(hydrazinylmethyl)-2-[2-[3-methyl-6-(methylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoate.
| Compound Name | ethyl 4-[4-(hydrazinylmethyl)-2-[2-[3-methyl-6-(methylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoate |
|---|---|
| PubChem CID | 142479000 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | ethyl 4-[4-(hydrazinylmethyl)-2-[2-[3-methyl-6-(methylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(CNN)cc1NC(=O)C(C)n1cc(C)c2ccc(C(=O)NC)cc21 |
| InChI | InChI=1S/C27H35N5O4/c1-5-36-25(33)8-6-7-20-10-9-19(15-30-28)13-23(20)31-26(34)18(3)32-16-17(2)22-12-11-21(14-24(22)32)27(35)29-4/h9-14,16,18,30H,5-8,15,28H2,1-4H3,(H,29,35)(H,31,34) |
| InChIKey | ZQZQVKJSRWSXBQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|