C23H26N4O4 — CID 142479699
(1S)-1-[1-[[5-[2-[4-[3-(oxetan-3-ylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol (PubChem CID 142479699) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is (1S)-1-[1-[[5-[2-[4-[3-(oxetan-3-ylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol.
| Compound Name | (1S)-1-[1-[[5-[2-[4-[3-(oxetan-3-ylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 142479699 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (1S)-1-[1-[[5-[2-[4-[3-(oxetan-3-ylamino)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
| SMILES | C[C@H](O)c1nccn1Cc1cc(C#Cc2ccc(OCCCNC3COC3)cc2)on1 |
| InChI | InChI=1S/C23H26N4O4/c1-17(28)23-25-10-11-27(23)14-19-13-22(31-26-19)8-5-18-3-6-21(7-4-18)30-12-2-9-24-20-15-29-16-20/h3-4,6-7,10-11,13,17,20,24,28H,2,9,12,14-16H2,1H3/t17-/m0/s1 |
| InChIKey | OXWIRLUKKTUJIR-KRWDZBQOSA-N |
| XLogP | 2.13 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|