C12H12F3N3O3 — CID 142479947
(2R)-6-oxo-N-[3-(trifluoromethoxy)phenyl]piperazine-2-carboxamide (PubChem CID 142479947) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is (2R)-6-oxo-N-[3-(trifluoromethoxy)phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-6-oxo-N-[3-(trifluoromethoxy)phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 142479947 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2R)-6-oxo-N-[3-(trifluoromethoxy)phenyl]piperazine-2-carboxamide |
| SMILES | O=C1CNC[C@H](C(=O)Nc2cccc(OC(F)(F)F)c2)N1 |
| InChI | InChI=1S/C12H12F3N3O3/c13-12(14,15)21-8-3-1-2-7(4-8)17-11(20)9-5-16-6-10(19)18-9/h1-4,9,16H,5-6H2,(H,17,20)(H,18,19)/t9-/m1/s1 |
| InChIKey | ROYRQQUGOWKIFK-SECBINFHSA-N |
| XLogP | 0.61 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |